C14H21BrO3S — CID 65016802
1-[2-(bromomethyl)-3,3-dimethylbutyl]sulfonyl-4-methoxybenzene (PubChem CID 65016802) has the molecular formula C14H21BrO3S and a molecular weight of 349.29 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-3,3-dimethylbutyl]sulfonyl-4-methoxybenzene.
| Compound Name | 1-[2-(bromomethyl)-3,3-dimethylbutyl]sulfonyl-4-methoxybenzene |
|---|---|
| PubChem CID | 65016802 |
| Molecular Formula | C14H21BrO3S |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 1-[2-(bromomethyl)-3,3-dimethylbutyl]sulfonyl-4-methoxybenzene |
| SMILES | COc1ccc(S(=O)(=O)CC(CBr)C(C)(C)C)cc1 |
| InChI | InChI=1S/C14H21BrO3S/c1-14(2,3)11(9-15)10-19(16,17)13-7-5-12(18-4)6-8-13/h5-8,11H,9-10H2,1-4H3 |
| InChIKey | VPQDMFVIZVVHJF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|