C15H23BrO2S — CID 65016650
4-[2-(bromomethyl)-3,3-dimethylbutyl]sulfonyl-1,2-dimethylbenzene (PubChem CID 65016650) has the molecular formula C15H23BrO2S and a molecular weight of 347.32 g/mol. Its IUPAC name is 4-[2-(bromomethyl)-3,3-dimethylbutyl]sulfonyl-1,2-dimethylbenzene.
| Compound Name | 4-[2-(bromomethyl)-3,3-dimethylbutyl]sulfonyl-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 65016650 |
| Molecular Formula | C15H23BrO2S |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 4-[2-(bromomethyl)-3,3-dimethylbutyl]sulfonyl-1,2-dimethylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)CC(CBr)C(C)(C)C)cc1C |
| InChI | InChI=1S/C15H23BrO2S/c1-11-6-7-14(8-12(11)2)19(17,18)10-13(9-16)15(3,4)5/h6-8,13H,9-10H2,1-5H3 |
| InChIKey | JKEUXZXOEOSRRJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|