C17H27BrO2S — CID 65004956
4-[2-(bromomethyl)-2-propylpentyl]sulfonyl-1,2-dimethylbenzene (PubChem CID 65004956) has the molecular formula C17H27BrO2S and a molecular weight of 375.37 g/mol. Its IUPAC name is 4-[2-(bromomethyl)-2-propylpentyl]sulfonyl-1,2-dimethylbenzene.
| Compound Name | 4-[2-(bromomethyl)-2-propylpentyl]sulfonyl-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 65004956 |
| Molecular Formula | C17H27BrO2S |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 4-[2-(bromomethyl)-2-propylpentyl]sulfonyl-1,2-dimethylbenzene |
| SMILES | CCCC(CBr)(CCC)CS(=O)(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C17H27BrO2S/c1-5-9-17(12-18,10-6-2)13-21(19,20)16-8-7-14(3)15(4)11-16/h7-8,11H,5-6,9-10,12-13H2,1-4H3 |
| InChIKey | KXABTPPZXBIMNL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|