C11H17NO2S — CID 64640024
2-(3,4-dimethylphenyl)sulfonyl-N-methylethanamine (PubChem CID 64640024) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)sulfonyl-N-methylethanamine.
| Compound Name | 2-(3,4-dimethylphenyl)sulfonyl-N-methylethanamine |
|---|---|
| PubChem CID | 64640024 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 2-(3,4-dimethylphenyl)sulfonyl-N-methylethanamine |
| SMILES | CNCCS(=O)(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C11H17NO2S/c1-9-4-5-11(8-10(9)2)15(13,14)7-6-12-3/h4-5,8,12H,6-7H2,1-3H3 |
| InChIKey | ZJSUCZYJXQSDPL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |