C13H20O3S — CID 56793096
4-(4-methoxybutylsulfonyl)-1,2-dimethylbenzene (PubChem CID 56793096) has the molecular formula C13H20O3S and a molecular weight of 256.37 g/mol. Its IUPAC name is 4-(4-methoxybutylsulfonyl)-1,2-dimethylbenzene.
| Compound Name | 4-(4-methoxybutylsulfonyl)-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 56793096 |
| Molecular Formula | C13H20O3S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 4-(4-methoxybutylsulfonyl)-1,2-dimethylbenzene |
| SMILES | COCCCCS(=O)(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C13H20O3S/c1-11-6-7-13(10-12(11)2)17(14,15)9-5-4-8-16-3/h6-7,10H,4-5,8-9H2,1-3H3 |
| InChIKey | KWXGJGQSGPIZJS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|