C23H32N2O10S2 — CID 157309811
3-(3,5-dimethyl-4-nitrophenyl)sulfonylpropan-1-ol;5-(3-methoxypropylsulfonyl)-1,3-dimethyl-2-nitrobenzene (PubChem CID 157309811) has the molecular formula C23H32N2O10S2 and a molecular weight of 560.65 g/mol. Its IUPAC name is 3-(3,5-dimethyl-4-nitrophenyl)sulfonylpropan-1-ol;5-(3-methoxypropylsulfonyl)-1,3-dimethyl-2-nitrobenzene.
| Compound Name | 3-(3,5-dimethyl-4-nitrophenyl)sulfonylpropan-1-ol;5-(3-methoxypropylsulfonyl)-1,3-dimethyl-2-nitrobenzene |
|---|---|
| PubChem CID | 157309811 |
| Molecular Formula | C23H32N2O10S2 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | 3-(3,5-dimethyl-4-nitrophenyl)sulfonylpropan-1-ol;5-(3-methoxypropylsulfonyl)-1,3-dimethyl-2-nitrobenzene |
| SMILES | COCCCS(=O)(=O)c1cc(C)c([N+](=O)[O-])c(C)c1.Cc1cc(S(=O)(=O)CCCO)cc(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17NO5S.C11H15NO5S/c1-9-7-11(8-10(2)12(9)13(14)15)19(16,17)6-4-5-18-3;1-8-6-10(18(16,17)5-3-4-13)7-9(2)11(8)12(14)15/h7-8H,4-6H2,1-3H3;6-7,13H,3-5H2,1-2H3 |
| InChIKey | BCXFSCNPVOWRKN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 184.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|