C12H18O4S — CID 116853242
3-(4-methoxy-3,5-dimethylphenyl)sulfonylpropan-1-ol (PubChem CID 116853242) has the molecular formula C12H18O4S and a molecular weight of 258.34 g/mol. Its IUPAC name is 3-(4-methoxy-3,5-dimethylphenyl)sulfonylpropan-1-ol.
| Compound Name | 3-(4-methoxy-3,5-dimethylphenyl)sulfonylpropan-1-ol |
|---|---|
| PubChem CID | 116853242 |
| Molecular Formula | C12H18O4S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 3-(4-methoxy-3,5-dimethylphenyl)sulfonylpropan-1-ol |
| SMILES | COc1c(C)cc(S(=O)(=O)CCCO)cc1C |
| InChI | InChI=1S/C12H18O4S/c1-9-7-11(8-10(2)12(9)16-3)17(14,15)6-4-5-13/h7-8,13H,4-6H2,1-3H3 |
| InChIKey | YHNUCGTYFXHUKB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |