C12H18O4S — CID 116853206
3-(4-ethoxy-3-methylphenyl)sulfonylpropan-1-ol (PubChem CID 116853206) has the molecular formula C12H18O4S and a molecular weight of 258.34 g/mol. Its IUPAC name is 3-(4-ethoxy-3-methylphenyl)sulfonylpropan-1-ol.
| Compound Name | 3-(4-ethoxy-3-methylphenyl)sulfonylpropan-1-ol |
|---|---|
| PubChem CID | 116853206 |
| Molecular Formula | C12H18O4S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 3-(4-ethoxy-3-methylphenyl)sulfonylpropan-1-ol |
| SMILES | CCOc1ccc(S(=O)(=O)CCCO)cc1C |
| InChI | InChI=1S/C12H18O4S/c1-3-16-12-6-5-11(9-10(12)2)17(14,15)8-4-7-13/h5-6,9,13H,3-4,7-8H2,1-2H3 |
| InChIKey | VKAUJCSBEAOQLE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |