About 4-[2-(3,4-dimethylphenyl)sulfonylethyl]-1H-pyrazole
4-[2-(3,4-dimethylphenyl)sulfonylethyl]-1H-pyrazole (PubChem CID 126828715) has the molecular formula C13H16N2O2S
and a molecular weight of 264.35 g/mol. Its IUPAC name is 4-[2-(3,4-dimethylphenyl)sulfonylethyl]-1H-pyrazole.
Molecular Properties
| Compound Name | 4-[2-(3,4-dimethylphenyl)sulfonylethyl]-1H-pyrazole |
| PubChem CID | 126828715 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 4-[2-(3,4-dimethylphenyl)sulfonylethyl]-1H-pyrazole |
| SMILES | Cc1ccc(S(=O)(=O)CCc2cn[nH]c2)cc1C |
| InChI | InChI=1S/C13H16N2O2S/c1-10-3-4-13(7-11(10)2)18(16,17)6-5-12-8-14-15-9-12/h3-4,7-9H,5-6H2,1-2H3,(H,14,15) |
| InChIKey | SEUVXBCHTCQSOL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-(3,4-dimethylphenyl)sulfonylethyl]-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(3,4-dimethylphenyl)sulfonylethyl]-1H-pyrazole?
The IUPAC name of 4-[2-(3,4-dimethylphenyl)sulfonylethyl]-1H-pyrazole (CID 126828715) is 4-[2-(3,4-dimethylphenyl)sulfonylethyl]-1H-pyrazole.
What is the SMILES notation for 4-[2-(3,4-dimethylphenyl)sulfonylethyl]-1H-pyrazole?
The canonical SMILES for 4-[2-(3,4-dimethylphenyl)sulfonylethyl]-1H-pyrazole is Cc1ccc(S(=O)(=O)CCc2cn[nH]c2)cc1C.
What is the InChIKey of 4-[2-(3,4-dimethylphenyl)sulfonylethyl]-1H-pyrazole?
The InChIKey is SEUVXBCHTCQSOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2S/c1-10-3-4-13(7-11(10)2)18(16,17)6-5-12-8-14-15-9-12/h3-4,7-9H,5-6H2,1-2H3,(H,14,15).
What are the key properties of 4-[2-(3,4-dimethylphenyl)sulfonylethyl]-1H-pyrazole?
4-[2-(3,4-dimethylphenyl)sulfonylethyl]-1H-pyrazole has a molecular weight of 264.35 g/mol, XLogP of 2.04, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3,4-dimethylphenyl)sulfonylethyl]-1H-pyrazole is sourced from PubChem (CID 126828715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).