C10H15NOS — CID 125425039
(3,4-dimethylphenyl)-ethyl-imino-oxo-λ6-sulfane (PubChem CID 125425039) has the molecular formula C10H15NOS and a molecular weight of 197.30 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-ethyl-imino-oxo-λ6-sulfane.
| Compound Name | (3,4-dimethylphenyl)-ethyl-imino-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 125425039 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | (3,4-dimethylphenyl)-ethyl-imino-oxo-λ6-sulfane |
| SMILES | [H]N=[S@@](=O)(CC)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C10H15NOS/c1-4-13(11,12)10-6-5-8(2)9(3)7-10/h5-7,11H,4H2,1-3H3/t13-/m1/s1 |
| InChIKey | QYJFVWHPIWLNNM-CYBMUJFWSA-N |
| XLogP | 2.73 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |