C16H24O5S — CID 148807965
tert-butyl (2S)-2-[(4-methoxyphenyl)sulfonylmethyl]butanoate (PubChem CID 148807965) has the molecular formula C16H24O5S and a molecular weight of 328.43 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(4-methoxyphenyl)sulfonylmethyl]butanoate.
| Compound Name | tert-butyl (2S)-2-[(4-methoxyphenyl)sulfonylmethyl]butanoate |
|---|---|
| PubChem CID | 148807965 |
| Molecular Formula | C16H24O5S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | tert-butyl (2S)-2-[(4-methoxyphenyl)sulfonylmethyl]butanoate |
| SMILES | CC[C@H](CS(=O)(=O)c1ccc(OC)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H24O5S/c1-6-12(15(17)21-16(2,3)4)11-22(18,19)14-9-7-13(20-5)8-10-14/h7-10,12H,6,11H2,1-5H3/t12-/m1/s1 |
| InChIKey | OPIMKROUEPPBIE-GFCCVEGCSA-N |
| XLogP | 2.84 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |