C16H21N2O2S+ — CID 2429370
1-methyl-4-naphthalen-2-ylsulfonyl-1,4-diazepan-1-ium (PubChem CID 2429370) has the molecular formula C16H21N2O2S+ and a molecular weight of 305.42 g/mol. Its IUPAC name is 1-methyl-4-naphthalen-2-ylsulfonyl-1,4-diazepan-1-ium.
| Compound Name | 1-methyl-4-naphthalen-2-ylsulfonyl-1,4-diazepan-1-ium |
|---|---|
| PubChem CID | 2429370 |
| Molecular Formula | C16H21N2O2S+ |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 1-methyl-4-naphthalen-2-ylsulfonyl-1,4-diazepan-1-ium |
| SMILES | C[NH+]1CCCN(S(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C16H20N2O2S/c1-17-9-4-10-18(12-11-17)21(19,20)16-8-7-14-5-2-3-6-15(14)13-16/h2-3,5-8,13H,4,9-12H2,1H3/p+1 |
| InChIKey | ZCJIXEKOBGHNCX-UHFFFAOYSA-O |
| XLogP | 0.75 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |