C14H21N2O3S+ — CID 2561934
1-[3-[(4-methyl-1,4-diazepan-4-ium-1-yl)sulfonyl]phenyl]ethanone (PubChem CID 2561934) has the molecular formula C14H21N2O3S+ and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-[3-[(4-methyl-1,4-diazepan-4-ium-1-yl)sulfonyl]phenyl]ethanone.
| Compound Name | 1-[3-[(4-methyl-1,4-diazepan-4-ium-1-yl)sulfonyl]phenyl]ethanone |
|---|---|
| PubChem CID | 2561934 |
| Molecular Formula | C14H21N2O3S+ |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 1-[3-[(4-methyl-1,4-diazepan-4-ium-1-yl)sulfonyl]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(S(=O)(=O)N2CCC[NH+](C)CC2)c1 |
| InChI | InChI=1S/C14H20N2O3S/c1-12(17)13-5-3-6-14(11-13)20(18,19)16-8-4-7-15(2)9-10-16/h3,5-6,11H,4,7-10H2,1-2H3/p+1 |
| InChIKey | WCBBPNRXQOWZSP-UHFFFAOYSA-O |
| XLogP | -0.20 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |