C25H25N3O6S — CID 70008677
4-[4-[3-(ethyliminocarbamoylamino)phenoxy]phenyl]sulfonyl-3-phenylbutanoic acid (PubChem CID 70008677) has the molecular formula C25H25N3O6S and a molecular weight of 495.56 g/mol. Its IUPAC name is 4-[4-[3-(ethyliminocarbamoylamino)phenoxy]phenyl]sulfonyl-3-phenylbutanoic acid.
| Compound Name | 4-[4-[3-(ethyliminocarbamoylamino)phenoxy]phenyl]sulfonyl-3-phenylbutanoic acid |
|---|---|
| PubChem CID | 70008677 |
| Molecular Formula | C25H25N3O6S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 4-[4-[3-(ethyliminocarbamoylamino)phenoxy]phenyl]sulfonyl-3-phenylbutanoic acid |
| SMILES | CC/N=N/C(=O)Nc1cccc(Oc2ccc(S(=O)(=O)CC(CC(=O)O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C25H25N3O6S/c1-2-26-28-25(31)27-20-9-6-10-22(16-20)34-21-11-13-23(14-12-21)35(32,33)17-19(15-24(29)30)18-7-4-3-5-8-18/h3-14,16,19H,2,15,17H2,1H3,(H,27,31)(H,29,30)/b28-26+ |
| InChIKey | ZCJFKFJCYCZVSC-BYCLXTJYSA-N |
| XLogP | 5.52 |
| TPSA | 134.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|