C27H28N2O5S2 — CID 22092968
3-phenyl-4-[4-[3-(thiomorpholine-4-carbonylamino)phenyl]phenyl]sulfonylbutanoic acid (PubChem CID 22092968) has the molecular formula C27H28N2O5S2 and a molecular weight of 524.66 g/mol. Its IUPAC name is 3-phenyl-4-[4-[3-(thiomorpholine-4-carbonylamino)phenyl]phenyl]sulfonylbutanoic acid.
| Compound Name | 3-phenyl-4-[4-[3-(thiomorpholine-4-carbonylamino)phenyl]phenyl]sulfonylbutanoic acid |
|---|---|
| PubChem CID | 22092968 |
| Molecular Formula | C27H28N2O5S2 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | 3-phenyl-4-[4-[3-(thiomorpholine-4-carbonylamino)phenyl]phenyl]sulfonylbutanoic acid |
| SMILES | O=C(O)CC(CS(=O)(=O)c1ccc(-c2cccc(NC(=O)N3CCSCC3)c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H28N2O5S2/c30-26(31)18-23(20-5-2-1-3-6-20)19-36(33,34)25-11-9-21(10-12-25)22-7-4-8-24(17-22)28-27(32)29-13-15-35-16-14-29/h1-12,17,23H,13-16,18-19H2,(H,28,32)(H,30,31) |
| InChIKey | KEBFDIWOKNLHJA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |