C23H29N3O2 — CID 72878185
4-[(1S,2S)-2-hydroxycyclohexyl]-N-(3-phenylphenyl)piperazine-1-carboxamide (PubChem CID 72878185) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 4-[(1S,2S)-2-hydroxycyclohexyl]-N-(3-phenylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[(1S,2S)-2-hydroxycyclohexyl]-N-(3-phenylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 72878185 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 4-[(1S,2S)-2-hydroxycyclohexyl]-N-(3-phenylphenyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1cccc(-c2ccccc2)c1)N1CCN([C@H]2CCCC[C@@H]2O)CC1 |
| InChI | InChI=1S/C23H29N3O2/c27-22-12-5-4-11-21(22)25-13-15-26(16-14-25)23(28)24-20-10-6-9-19(17-20)18-7-2-1-3-8-18/h1-3,6-10,17,21-22,27H,4-5,11-16H2,(H,24,28)/t21-,22-/m0/s1 |
| InChIKey | YXSUDDWKVQIBTA-VXKWHMMOSA-N |
| XLogP | 3.81 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |