C26H36N8O2 — CID 72700058
1-N-(3-phenylphenyl)-4-N,4-N-di(piperazin-2-yl)piperazine-1,4-dicarboxamide (PubChem CID 72700058) has the molecular formula C26H36N8O2 and a molecular weight of 492.63 g/mol. Its IUPAC name is 1-N-(3-phenylphenyl)-4-N,4-N-di(piperazin-2-yl)piperazine-1,4-dicarboxamide.
| Compound Name | 1-N-(3-phenylphenyl)-4-N,4-N-di(piperazin-2-yl)piperazine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 72700058 |
| Molecular Formula | C26H36N8O2 |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | 1-N-(3-phenylphenyl)-4-N,4-N-di(piperazin-2-yl)piperazine-1,4-dicarboxamide |
| SMILES | O=C(Nc1cccc(-c2ccccc2)c1)N1CCN(C(=O)N(C2CNCCN2)C2CNCCN2)CC1 |
| InChI | InChI=1S/C26H36N8O2/c35-25(31-22-8-4-7-21(17-22)20-5-2-1-3-6-20)32-13-15-33(16-14-32)26(36)34(23-18-27-9-11-29-23)24-19-28-10-12-30-24/h1-8,17,23-24,27-30H,9-16,18-19H2,(H,31,35) |
| InChIKey | USHMPFWDOCABAR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |