C24H28N6O4 — CID 55817230
4-(2-oxo-2-pyrrolidin-1-ylacetyl)-N-[3-(phenylcarbamoylamino)phenyl]piperazine-1-carboxamide (PubChem CID 55817230) has the molecular formula C24H28N6O4 and a molecular weight of 464.53 g/mol. Its IUPAC name is 4-(2-oxo-2-pyrrolidin-1-ylacetyl)-N-[3-(phenylcarbamoylamino)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-(2-oxo-2-pyrrolidin-1-ylacetyl)-N-[3-(phenylcarbamoylamino)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55817230 |
| Molecular Formula | C24H28N6O4 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 4-(2-oxo-2-pyrrolidin-1-ylacetyl)-N-[3-(phenylcarbamoylamino)phenyl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)Nc1cccc(NC(=O)N2CCN(C(=O)C(=O)N3CCCC3)CC2)c1 |
| InChI | InChI=1S/C24H28N6O4/c31-21(28-11-4-5-12-28)22(32)29-13-15-30(16-14-29)24(34)27-20-10-6-9-19(17-20)26-23(33)25-18-7-2-1-3-8-18/h1-3,6-10,17H,4-5,11-16H2,(H,27,34)(H2,25,26,33) |
| InChIKey | YGLXEJIUCYQAEP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|