C21H27N5O4 — CID 55819910
N-[3-(cyclopropanecarbonylamino)phenyl]-4-(2-oxo-2-pyrrolidin-1-ylacetyl)piperazine-1-carboxamide (PubChem CID 55819910) has the molecular formula C21H27N5O4 and a molecular weight of 413.48 g/mol. Its IUPAC name is N-[3-(cyclopropanecarbonylamino)phenyl]-4-(2-oxo-2-pyrrolidin-1-ylacetyl)piperazine-1-carboxamide.
| Compound Name | N-[3-(cyclopropanecarbonylamino)phenyl]-4-(2-oxo-2-pyrrolidin-1-ylacetyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55819910 |
| Molecular Formula | C21H27N5O4 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N-[3-(cyclopropanecarbonylamino)phenyl]-4-(2-oxo-2-pyrrolidin-1-ylacetyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)N2CCN(C(=O)C(=O)N3CCCC3)CC2)c1)C1CC1 |
| InChI | InChI=1S/C21H27N5O4/c27-18(15-6-7-15)22-16-4-3-5-17(14-16)23-21(30)26-12-10-25(11-13-26)20(29)19(28)24-8-1-2-9-24/h3-5,14-15H,1-2,6-13H2,(H,22,27)(H,23,30) |
| InChIKey | AXGPWBGTNKGSST-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|