C25H26N2O — CID 44555474
3-methyl-3-phenyl-N-(3-phenylphenyl)piperidine-1-carboxamide (PubChem CID 44555474) has the molecular formula C25H26N2O and a molecular weight of 370.50 g/mol. Its IUPAC name is 3-methyl-3-phenyl-N-(3-phenylphenyl)piperidine-1-carboxamide.
| Compound Name | 3-methyl-3-phenyl-N-(3-phenylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 44555474 |
| Molecular Formula | C25H26N2O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 3-methyl-3-phenyl-N-(3-phenylphenyl)piperidine-1-carboxamide |
| SMILES | CC1(c2ccccc2)CCCN(C(=O)Nc2cccc(-c3ccccc3)c2)C1 |
| InChI | InChI=1S/C25H26N2O/c1-25(22-13-6-3-7-14-22)16-9-17-27(19-25)24(28)26-23-15-8-12-21(18-23)20-10-4-2-5-11-20/h2-8,10-15,18H,9,16-17,19H2,1H3,(H,26,28) |
| InChIKey | XACXPRAUSRXTEC-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |