C17H27ClN2O — CID 119786972
2-methyl-3-(methylamino)-1-(3-methyl-3-phenylpiperidin-1-yl)propan-1-one;hydrochloride (PubChem CID 119786972) has the molecular formula C17H27ClN2O and a molecular weight of 310.87 g/mol. Its IUPAC name is 2-methyl-3-(methylamino)-1-(3-methyl-3-phenylpiperidin-1-yl)propan-1-one;hydrochloride.
| Compound Name | 2-methyl-3-(methylamino)-1-(3-methyl-3-phenylpiperidin-1-yl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119786972 |
| Molecular Formula | C17H27ClN2O |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2-methyl-3-(methylamino)-1-(3-methyl-3-phenylpiperidin-1-yl)propan-1-one;hydrochloride |
| SMILES | CNCC(C)C(=O)N1CCCC(C)(c2ccccc2)C1.Cl |
| InChI | InChI=1S/C17H26N2O.ClH/c1-14(12-18-3)16(20)19-11-7-10-17(2,13-19)15-8-5-4-6-9-15;/h4-6,8-9,14,18H,7,10-13H2,1-3H3;1H |
| InChIKey | WOPJGSQHDIJXJJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |