C15H21N3O2 — CID 97141328
[2-[(3S)-3-methyl-3-phenylpiperidin-1-yl]-2-oxoethyl]urea (PubChem CID 97141328) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is [2-[(3S)-3-methyl-3-phenylpiperidin-1-yl]-2-oxoethyl]urea.
| Compound Name | [2-[(3S)-3-methyl-3-phenylpiperidin-1-yl]-2-oxoethyl]urea |
|---|---|
| PubChem CID | 97141328 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | [2-[(3S)-3-methyl-3-phenylpiperidin-1-yl]-2-oxoethyl]urea |
| SMILES | C[C@@]1(c2ccccc2)CCCN(C(=O)CNC(N)=O)C1 |
| InChI | InChI=1S/C15H21N3O2/c1-15(12-6-3-2-4-7-12)8-5-9-18(11-15)13(19)10-17-14(16)20/h2-4,6-7H,5,8-11H2,1H3,(H3,16,17,20)/t15-/m1/s1 |
| InChIKey | YNGKSHRYQXFRAE-OAHLLOKOSA-N |
| XLogP | 1.24 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |