C27H28N4O — CID 42643842
N-[[4-(1H-indazol-6-yl)phenyl]methyl]-3-methyl-3-phenylpiperidine-1-carboxamide (PubChem CID 42643842) has the molecular formula C27H28N4O and a molecular weight of 424.55 g/mol. Its IUPAC name is N-[[4-(1H-indazol-6-yl)phenyl]methyl]-3-methyl-3-phenylpiperidine-1-carboxamide.
| Compound Name | N-[[4-(1H-indazol-6-yl)phenyl]methyl]-3-methyl-3-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 42643842 |
| Molecular Formula | C27H28N4O |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | N-[[4-(1H-indazol-6-yl)phenyl]methyl]-3-methyl-3-phenylpiperidine-1-carboxamide |
| SMILES | CC1(c2ccccc2)CCCN(C(=O)NCc2ccc(-c3ccc4cn[nH]c4c3)cc2)C1 |
| InChI | InChI=1S/C27H28N4O/c1-27(24-6-3-2-4-7-24)14-5-15-31(19-27)26(32)28-17-20-8-10-21(11-9-20)22-12-13-23-18-29-30-25(23)16-22/h2-4,6-13,16,18H,5,14-15,17,19H2,1H3,(H,28,32)(H,29,30) |
| InChIKey | BXDHEKWRLXJSFP-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |