C17H25ClN4O2 — CID 119700260
N-phenyl-4-(pyrrolidine-3-carbonylamino)piperidine-1-carboxamide;hydrochloride (PubChem CID 119700260) has the molecular formula C17H25ClN4O2 and a molecular weight of 352.87 g/mol. Its IUPAC name is N-phenyl-4-(pyrrolidine-3-carbonylamino)piperidine-1-carboxamide;hydrochloride.
| Compound Name | N-phenyl-4-(pyrrolidine-3-carbonylamino)piperidine-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119700260 |
| Molecular Formula | C17H25ClN4O2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | N-phenyl-4-(pyrrolidine-3-carbonylamino)piperidine-1-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCN(C(=O)Nc2ccccc2)CC1)C1CCNC1 |
| InChI | InChI=1S/C17H24N4O2.ClH/c22-16(13-6-9-18-12-13)19-15-7-10-21(11-8-15)17(23)20-14-4-2-1-3-5-14;/h1-5,13,15,18H,6-12H2,(H,19,22)(H,20,23);1H |
| InChIKey | COUMDQGCYZPWEQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |