C29H32N4O3 — CID 134042483
1-(naphthalene-1-carbonyl)-N-[1-(phenylcarbamoyl)piperidin-4-yl]piperidine-4-carboxamide (PubChem CID 134042483) has the molecular formula C29H32N4O3 and a molecular weight of 484.60 g/mol. Its IUPAC name is 1-(naphthalene-1-carbonyl)-N-[1-(phenylcarbamoyl)piperidin-4-yl]piperidine-4-carboxamide.
| Compound Name | 1-(naphthalene-1-carbonyl)-N-[1-(phenylcarbamoyl)piperidin-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 134042483 |
| Molecular Formula | C29H32N4O3 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 1-(naphthalene-1-carbonyl)-N-[1-(phenylcarbamoyl)piperidin-4-yl]piperidine-4-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)Nc2ccccc2)CC1)C1CCN(C(=O)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C29H32N4O3/c34-27(30-24-15-19-33(20-16-24)29(36)31-23-9-2-1-3-10-23)22-13-17-32(18-14-22)28(35)26-12-6-8-21-7-4-5-11-25(21)26/h1-12,22,24H,13-20H2,(H,30,34)(H,31,36) |
| InChIKey | BNCRGIYFZMOODA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |