C19H22N2O3 — CID 118767375
(3S,4S)-3,4-dihydroxy-N-[3-(3-methylphenyl)phenyl]piperidine-1-carboxamide (PubChem CID 118767375) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is (3S,4S)-3,4-dihydroxy-N-[3-(3-methylphenyl)phenyl]piperidine-1-carboxamide.
| Compound Name | (3S,4S)-3,4-dihydroxy-N-[3-(3-methylphenyl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 118767375 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (3S,4S)-3,4-dihydroxy-N-[3-(3-methylphenyl)phenyl]piperidine-1-carboxamide |
| SMILES | Cc1cccc(-c2cccc(NC(=O)N3CC[C@H](O)[C@@H](O)C3)c2)c1 |
| InChI | InChI=1S/C19H22N2O3/c1-13-4-2-5-14(10-13)15-6-3-7-16(11-15)20-19(24)21-9-8-17(22)18(23)12-21/h2-7,10-11,17-18,22-23H,8-9,12H2,1H3,(H,20,24)/t17-,18-/m0/s1 |
| InChIKey | MIBHUNLOMDRIIR-ROUUACIJSA-N |
| XLogP | 2.62 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |