C26H28N2O7S — CID 91024705
4-[4-[[5-[formyl(methylamino)amino]-2-methoxyphenyl]methoxy]phenyl]sulfonyl-3-phenylbutanoic acid (PubChem CID 91024705) has the molecular formula C26H28N2O7S and a molecular weight of 512.58 g/mol. Its IUPAC name is 4-[4-[[5-[formyl(methylamino)amino]-2-methoxyphenyl]methoxy]phenyl]sulfonyl-3-phenylbutanoic acid.
| Compound Name | 4-[4-[[5-[formyl(methylamino)amino]-2-methoxyphenyl]methoxy]phenyl]sulfonyl-3-phenylbutanoic acid |
|---|---|
| PubChem CID | 91024705 |
| Molecular Formula | C26H28N2O7S |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 4-[4-[[5-[formyl(methylamino)amino]-2-methoxyphenyl]methoxy]phenyl]sulfonyl-3-phenylbutanoic acid |
| SMILES | CNN(C=O)c1ccc(OC)c(COc2ccc(S(=O)(=O)CC(CC(=O)O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C26H28N2O7S/c1-27-28(18-29)22-8-13-25(34-2)20(14-22)16-35-23-9-11-24(12-10-23)36(32,33)17-21(15-26(30)31)19-6-4-3-5-7-19/h3-14,18,21,27H,15-17H2,1-2H3,(H,30,31) |
| InChIKey | LSZDGUOSLNBMFX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|