C26H22F3NO5S2 — CID 91507178
methyl (3R)-4-[4-[[3-isothiocyanato-5-(trifluoromethyl)phenyl]methoxy]phenyl]sulfonyl-3-phenylbutanoate (PubChem CID 91507178) has the molecular formula C26H22F3NO5S2 and a molecular weight of 549.59 g/mol. Its IUPAC name is methyl (3R)-4-[4-[[3-isothiocyanato-5-(trifluoromethyl)phenyl]methoxy]phenyl]sulfonyl-3-phenylbutanoate.
| Compound Name | methyl (3R)-4-[4-[[3-isothiocyanato-5-(trifluoromethyl)phenyl]methoxy]phenyl]sulfonyl-3-phenylbutanoate |
|---|---|
| PubChem CID | 91507178 |
| Molecular Formula | C26H22F3NO5S2 |
| Molecular Weight | 549.59 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | methyl (3R)-4-[4-[[3-isothiocyanato-5-(trifluoromethyl)phenyl]methoxy]phenyl]sulfonyl-3-phenylbutanoate |
| SMILES | COC(=O)CC(CS(=O)(=O)c1ccc(OCc2cc(N=C=S)cc(C(F)(F)F)c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H22F3NO5S2/c1-34-25(31)13-20(19-5-3-2-4-6-19)16-37(32,33)24-9-7-23(8-10-24)35-15-18-11-21(26(27,28)29)14-22(12-18)30-17-36/h2-12,14,20H,13,15-16H2,1H3 |
| InChIKey | IUSFFHJNJVFATP-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.59 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|