C25H22Cl2F3NO7S — CID 142264948
methyl 3-(3,5-dichlorophenyl)-4-[4-[[3-nitro-5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methoxy]phenyl]sulfonylbutanoate (PubChem CID 142264948) has the molecular formula C25H22Cl2F3NO7S and a molecular weight of 608.42 g/mol. Its IUPAC name is methyl 3-(3,5-dichlorophenyl)-4-[4-[[3-nitro-5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methoxy]phenyl]sulfonylbutanoate.
| Compound Name | methyl 3-(3,5-dichlorophenyl)-4-[4-[[3-nitro-5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methoxy]phenyl]sulfonylbutanoate |
|---|---|
| PubChem CID | 142264948 |
| Molecular Formula | C25H22Cl2F3NO7S |
| Molecular Weight | 608.42 g/mol |
| Exact Mass | 607.04 |
| IUPAC Name | methyl 3-(3,5-dichlorophenyl)-4-[4-[[3-nitro-5-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methoxy]phenyl]sulfonylbutanoate |
| SMILES | COC(=O)CC(CS(=O)(=O)c1ccc(OCC2=CC([N+](=O)[O-])=CC(C(F)(F)F)C2)cc1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C25H22Cl2F3NO7S/c1-37-24(32)10-17(16-8-19(26)12-20(27)9-16)14-39(35,36)23-4-2-22(3-5-23)38-13-15-6-18(25(28,29)30)11-21(7-15)31(33)34/h2-5,7-9,11-12,17-18H,6,10,13-14H2,1H3 |
| InChIKey | TXMSBHROOADIQV-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.42 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|