C13H15ClN2O6S — CID 95975412
methyl (3R)-3-[(4-chloro-2-nitrophenyl)sulfonylamino]-3-cyclopropylpropanoate (PubChem CID 95975412) has the molecular formula C13H15ClN2O6S and a molecular weight of 362.79 g/mol. Its IUPAC name is methyl (3R)-3-[(4-chloro-2-nitrophenyl)sulfonylamino]-3-cyclopropylpropanoate.
| Compound Name | methyl (3R)-3-[(4-chloro-2-nitrophenyl)sulfonylamino]-3-cyclopropylpropanoate |
|---|---|
| PubChem CID | 95975412 |
| Molecular Formula | C13H15ClN2O6S |
| Molecular Weight | 362.79 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | methyl (3R)-3-[(4-chloro-2-nitrophenyl)sulfonylamino]-3-cyclopropylpropanoate |
| SMILES | COC(=O)C[C@@H](NS(=O)(=O)c1ccc(Cl)cc1[N+](=O)[O-])C1CC1 |
| InChI | InChI=1S/C13H15ClN2O6S/c1-22-13(17)7-10(8-2-3-8)15-23(20,21)12-5-4-9(14)6-11(12)16(18)19/h4-6,8,10,15H,2-3,7H2,1H3/t10-/m1/s1 |
| InChIKey | IXCOMBZNRKOKJZ-SNVBAGLBSA-N |
| XLogP | 1.87 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.79 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|