About methyl (3S)-3-[(2-bromo-4,5-dimethoxyphenyl)sulfonylamino]-3-cyclopropylpropanoate
methyl (3S)-3-[(2-bromo-4,5-dimethoxyphenyl)sulfonylamino]-3-cyclopropylpropanoate (PubChem CID 96535948) has the molecular formula C15H20BrNO6S
and a molecular weight of 422.30 g/mol. Its IUPAC name is methyl (3S)-3-[(2-bromo-4,5-dimethoxyphenyl)sulfonylamino]-3-cyclopropylpropanoate.
Molecular Properties
| Compound Name | methyl (3S)-3-[(2-bromo-4,5-dimethoxyphenyl)sulfonylamino]-3-cyclopropylpropanoate |
| PubChem CID | 96535948 |
| Molecular Formula | C15H20BrNO6S |
| Molecular Weight | 422.30 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | methyl (3S)-3-[(2-bromo-4,5-dimethoxyphenyl)sulfonylamino]-3-cyclopropylpropanoate |
| SMILES | COC(=O)C[C@H](NS(=O)(=O)c1cc(OC)c(OC)cc1Br)C1CC1 |
| InChI | InChI=1S/C15H20BrNO6S/c1-21-12-6-10(16)14(8-13(12)22-2)24(19,20)17-11(9-4-5-9)7-15(18)23-3/h6,8-9,11,17H,4-5,7H2,1-3H3/t11-/m0/s1 |
| InChIKey | UDUVHTRVNARBJA-NSHDSACASA-N |
| XLogP | 2.09 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl (3S)-3-[(2-bromo-4,5-dimethoxyphenyl)sulfonylamino]-3-cyclopropylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-3-[(2-bromo-4,5-dimethoxyphenyl)sulfonylamino]-3-cyclopropylpropanoate?
The IUPAC name of methyl (3S)-3-[(2-bromo-4,5-dimethoxyphenyl)sulfonylamino]-3-cyclopropylpropanoate (CID 96535948) is methyl (3S)-3-[(2-bromo-4,5-dimethoxyphenyl)sulfonylamino]-3-cyclopropylpropanoate.
What is the SMILES notation for methyl (3S)-3-[(2-bromo-4,5-dimethoxyphenyl)sulfonylamino]-3-cyclopropylpropanoate?
The canonical SMILES for methyl (3S)-3-[(2-bromo-4,5-dimethoxyphenyl)sulfonylamino]-3-cyclopropylpropanoate is COC(=O)C[C@H](NS(=O)(=O)c1cc(OC)c(OC)cc1Br)C1CC1.
What is the InChIKey of methyl (3S)-3-[(2-bromo-4,5-dimethoxyphenyl)sulfonylamino]-3-cyclopropylpropanoate?
The InChIKey is UDUVHTRVNARBJA-NSHDSACASA-N. The full InChI is InChI=1S/C15H20BrNO6S/c1-21-12-6-10(16)14(8-13(12)22-2)24(19,20)17-11(9-4-5-9)7-15(18)23-3/h6,8-9,11,17H,4-5,7H2,1-3H3/t11-/m0/s1.
What are the key properties of methyl (3S)-3-[(2-bromo-4,5-dimethoxyphenyl)sulfonylamino]-3-cyclopropylpropanoate?
methyl (3S)-3-[(2-bromo-4,5-dimethoxyphenyl)sulfonylamino]-3-cyclopropylpropanoate has a molecular weight of 422.30 g/mol, XLogP of 2.09, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-3-[(2-bromo-4,5-dimethoxyphenyl)sulfonylamino]-3-cyclopropylpropanoate is sourced from PubChem (CID 96535948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).