C16H18BrNO4S — CID 9185826
2-bromo-4,5-dimethoxy-N-[(1R)-1-phenylethyl]benzenesulfonamide (PubChem CID 9185826) has the molecular formula C16H18BrNO4S and a molecular weight of 400.29 g/mol. Its IUPAC name is 2-bromo-4,5-dimethoxy-N-[(1R)-1-phenylethyl]benzenesulfonamide.
| Compound Name | 2-bromo-4,5-dimethoxy-N-[(1R)-1-phenylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 9185826 |
| Molecular Formula | C16H18BrNO4S |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | 2-bromo-4,5-dimethoxy-N-[(1R)-1-phenylethyl]benzenesulfonamide |
| SMILES | COc1cc(Br)c(S(=O)(=O)N[C@H](C)c2ccccc2)cc1OC |
| InChI | InChI=1S/C16H18BrNO4S/c1-11(12-7-5-4-6-8-12)18-23(19,20)16-10-15(22-3)14(21-2)9-13(16)17/h4-11,18H,1-3H3/t11-/m1/s1 |
| InChIKey | WUFHJMUVANOYDX-LLVKDONJSA-N |
| XLogP | 3.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |