C16H18BrNO2S — CID 94163199
5-bromo-2,4-dimethyl-N-[(1R)-1-phenylethyl]benzenesulfonamide (PubChem CID 94163199) has the molecular formula C16H18BrNO2S and a molecular weight of 368.30 g/mol. Its IUPAC name is 5-bromo-2,4-dimethyl-N-[(1R)-1-phenylethyl]benzenesulfonamide.
| Compound Name | 5-bromo-2,4-dimethyl-N-[(1R)-1-phenylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 94163199 |
| Molecular Formula | C16H18BrNO2S |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 5-bromo-2,4-dimethyl-N-[(1R)-1-phenylethyl]benzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N[C@H](C)c2ccccc2)cc1Br |
| InChI | InChI=1S/C16H18BrNO2S/c1-11-9-12(2)16(10-15(11)17)21(19,20)18-13(3)14-7-5-4-6-8-14/h4-10,13,18H,1-3H3/t13-/m1/s1 |
| InChIKey | ZRBLQCYODABLNT-CYBMUJFWSA-N |
| XLogP | 4.11 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |