C25H25F2NO5S — CID 142264953
methyl 4-[4-[difluoro-[4-(methoxyamino)phenyl]methyl]phenyl]sulfonyl-3-phenylbutanoate (PubChem CID 142264953) has the molecular formula C25H25F2NO5S and a molecular weight of 489.54 g/mol. Its IUPAC name is methyl 4-[4-[difluoro-[4-(methoxyamino)phenyl]methyl]phenyl]sulfonyl-3-phenylbutanoate.
| Compound Name | methyl 4-[4-[difluoro-[4-(methoxyamino)phenyl]methyl]phenyl]sulfonyl-3-phenylbutanoate |
|---|---|
| PubChem CID | 142264953 |
| Molecular Formula | C25H25F2NO5S |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | methyl 4-[4-[difluoro-[4-(methoxyamino)phenyl]methyl]phenyl]sulfonyl-3-phenylbutanoate |
| SMILES | CONc1ccc(C(F)(F)c2ccc(S(=O)(=O)CC(CC(=O)OC)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H25F2NO5S/c1-32-24(29)16-19(18-6-4-3-5-7-18)17-34(30,31)23-14-10-21(11-15-23)25(26,27)20-8-12-22(13-9-20)28-33-2/h3-15,19,28H,16-17H2,1-2H3 |
| InChIKey | BQWSZHHPZFHROB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|