C14H20F2O2Si — CID 122229851
methyl 4,4-difluoro-3-phenyl-4-trimethylsilylbutanoate (PubChem CID 122229851) has the molecular formula C14H20F2O2Si and a molecular weight of 286.39 g/mol. Its IUPAC name is methyl 4,4-difluoro-3-phenyl-4-trimethylsilylbutanoate.
| Compound Name | methyl 4,4-difluoro-3-phenyl-4-trimethylsilylbutanoate |
|---|---|
| PubChem CID | 122229851 |
| Molecular Formula | C14H20F2O2Si |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | methyl 4,4-difluoro-3-phenyl-4-trimethylsilylbutanoate |
| SMILES | COC(=O)CC(c1ccccc1)C(F)(F)[Si](C)(C)C |
| InChI | InChI=1S/C14H20F2O2Si/c1-18-13(17)10-12(11-8-6-5-7-9-11)14(15,16)19(2,3)4/h5-9,12H,10H2,1-4H3 |
| InChIKey | BWNCLSMHAWMNMJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|