C11H11F3O3 — CID 71018559
methyl 4,4,4-trifluoro-3-(3-hydroxyphenyl)butanoate (PubChem CID 71018559) has the molecular formula C11H11F3O3 and a molecular weight of 248.20 g/mol. Its IUPAC name is methyl 4,4,4-trifluoro-3-(3-hydroxyphenyl)butanoate.
| Compound Name | methyl 4,4,4-trifluoro-3-(3-hydroxyphenyl)butanoate |
|---|---|
| PubChem CID | 71018559 |
| Molecular Formula | C11H11F3O3 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | methyl 4,4,4-trifluoro-3-(3-hydroxyphenyl)butanoate |
| SMILES | COC(=O)CC(c1cccc(O)c1)C(F)(F)F |
| InChI | InChI=1S/C11H11F3O3/c1-17-10(16)6-9(11(12,13)14)7-3-2-4-8(15)5-7/h2-5,9,15H,6H2,1H3 |
| InChIKey | BVGRPNSBTLTLHA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |