C27H28N4O5S — CID 10152585
4-[4-[[3-[(N-cyano-N'-methylcarbamimidoyl)amino]-4-methylphenyl]methoxy]phenyl]sulfonyl-3-phenylbutanoic acid (PubChem CID 10152585) has the molecular formula C27H28N4O5S and a molecular weight of 520.61 g/mol. Its IUPAC name is 4-[4-[[3-[(N-cyano-N'-methylcarbamimidoyl)amino]-4-methylphenyl]methoxy]phenyl]sulfonyl-3-phenylbutanoic acid.
| Compound Name | 4-[4-[[3-[(N-cyano-N'-methylcarbamimidoyl)amino]-4-methylphenyl]methoxy]phenyl]sulfonyl-3-phenylbutanoic acid |
|---|---|
| PubChem CID | 10152585 |
| Molecular Formula | C27H28N4O5S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 4-[4-[[3-[(N-cyano-N'-methylcarbamimidoyl)amino]-4-methylphenyl]methoxy]phenyl]sulfonyl-3-phenylbutanoic acid |
| SMILES | C/N=C(\NC#N)Nc1cc(COc2ccc(S(=O)(=O)CC(CC(=O)O)c3ccccc3)cc2)ccc1C |
| InChI | InChI=1S/C27H28N4O5S/c1-19-8-9-20(14-25(19)31-27(29-2)30-18-28)16-36-23-10-12-24(13-11-23)37(34,35)17-22(15-26(32)33)21-6-4-3-5-7-21/h3-14,22H,15-17H2,1-2H3,(H,32,33)(H2,29,30,31) |
| InChIKey | DIMSMZJXUXCKIF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 140.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|