C31H26BF4NO2 — CID 62707027
3-(1-methylpyridin-1-ium-4-yl)-1,5-dinaphthalen-2-ylpentane-1,5-dione tetrafluoroborate (PubChem CID 62707027) has the molecular formula C31H26BF4NO2 and a molecular weight of 531.36 g/mol. Its IUPAC name is 3-(1-methylpyridin-1-ium-4-yl)-1,5-dinaphthalen-2-ylpentane-1,5-dione tetrafluoroborate.
| Compound Name | 3-(1-methylpyridin-1-ium-4-yl)-1,5-dinaphthalen-2-ylpentane-1,5-dione tetrafluoroborate |
|---|---|
| PubChem CID | 62707027 |
| Molecular Formula | C31H26BF4NO2 |
| Molecular Weight | 531.36 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | 3-(1-methylpyridin-1-ium-4-yl)-1,5-dinaphthalen-2-ylpentane-1,5-dione tetrafluoroborate |
| SMILES | C[n+]1ccc(C(CC(=O)c2ccc3ccccc3c2)CC(=O)c2ccc3ccccc3c2)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C31H26NO2.BF4/c1-32-16-14-24(15-17-32)29(20-30(33)27-12-10-22-6-2-4-8-25(22)18-27)21-31(34)28-13-11-23-7-3-5-9-26(23)19-28;2-1(3,4)5/h2-19,29H,20-21H2,1H3;/q+1;-1 |
| InChIKey | XKFRCRKCMWWJQD-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 38.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.36 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|