C21H26 — CID 172611470
2-[(2Z,8E)-undeca-2,8-dien-2-yl]naphthalene (PubChem CID 172611470) has the molecular formula C21H26 and a molecular weight of 278.44 g/mol. Its IUPAC name is 2-[(2Z,8E)-undeca-2,8-dien-2-yl]naphthalene.
| Compound Name | 2-[(2Z,8E)-undeca-2,8-dien-2-yl]naphthalene |
|---|---|
| PubChem CID | 172611470 |
| Molecular Formula | C21H26 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 2-[(2Z,8E)-undeca-2,8-dien-2-yl]naphthalene |
| SMILES | CC/C=C/CCCC/C=C(/C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H26/c1-3-4-5-6-7-8-9-12-18(2)20-16-15-19-13-10-11-14-21(19)17-20/h4-5,10-17H,3,6-9H2,1-2H3/b5-4+,18-12- |
| InChIKey | SLWZHCLVXXOALJ-WEQJRMIKSA-N |
| XLogP | 6.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|