C22H31P — CID 142975654
(1,4-dimethylcyclohexa-2,4-dien-1-yl)phosphane;1-methyl-4-[(2E)-5-methylhexa-2,5-dien-2-yl]benzene (PubChem CID 142975654) has the molecular formula C22H31P and a molecular weight of 326.46 g/mol. Its IUPAC name is (1,4-dimethylcyclohexa-2,4-dien-1-yl)phosphane;1-methyl-4-[(2E)-5-methylhexa-2,5-dien-2-yl]benzene.
| Compound Name | (1,4-dimethylcyclohexa-2,4-dien-1-yl)phosphane;1-methyl-4-[(2E)-5-methylhexa-2,5-dien-2-yl]benzene |
|---|---|
| PubChem CID | 142975654 |
| Molecular Formula | C22H31P |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (1,4-dimethylcyclohexa-2,4-dien-1-yl)phosphane;1-methyl-4-[(2E)-5-methylhexa-2,5-dien-2-yl]benzene |
| SMILES | C=C(C)C/C=C(\C)c1ccc(C)cc1.CC1=CCC(C)(P)C=C1 |
| InChI | InChI=1S/C14H18.C8H13P/c1-11(2)5-8-13(4)14-9-6-12(3)7-10-14;1-7-3-5-8(2,9)6-4-7/h6-10H,1,5H2,2-4H3;3-5H,6,9H2,1-2H3/b13-8+; |
| InChIKey | SLZQIRLKCMEEKM-FNXZNAJJSA-N |
| XLogP | 6.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|