C21H29NO — CID 167214327
2-methyl-2-phenyl-N-[(4E)-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]butanamide (PubChem CID 167214327) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is 2-methyl-2-phenyl-N-[(4E)-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]butanamide.
| Compound Name | 2-methyl-2-phenyl-N-[(4E)-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]butanamide |
|---|---|
| PubChem CID | 167214327 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 2-methyl-2-phenyl-N-[(4E)-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]butanamide |
| SMILES | C=C/C=C(\C=C/C)C(CC)NC(=O)C(C)(CC)c1ccccc1 |
| InChI | InChI=1S/C21H29NO/c1-6-13-17(14-7-2)19(8-3)22-20(23)21(5,9-4)18-15-11-10-12-16-18/h6-7,10-16,19H,1,8-9H2,2-5H3,(H,22,23)/b14-7-,17-13+ |
| InChIKey | TXQSMYOXOITLJL-IQVCKYCWSA-N |
| XLogP | 4.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|