About 2-methyl-2-phenyl-N-[(4E)-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]butanamide
2-methyl-2-phenyl-N-[(4E)-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]butanamide (PubChem CID 167214327) has the molecular formula C21H29NO
and a molecular weight of 311.47 g/mol. Its IUPAC name is 2-methyl-2-phenyl-N-[(4E)-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]butanamide.
Molecular Properties
| Compound Name | 2-methyl-2-phenyl-N-[(4E)-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]butanamide |
| PubChem CID | 167214327 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 2-methyl-2-phenyl-N-[(4E)-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]butanamide |
| SMILES | C=C/C=C(\C=C/C)C(CC)NC(=O)C(C)(CC)c1ccccc1 |
| InChI | InChI=1S/C21H29NO/c1-6-13-17(14-7-2)19(8-3)22-20(23)21(5,9-4)18-15-11-10-12-16-18/h6-7,10-16,19H,1,8-9H2,2-5H3,(H,22,23)/b14-7-,17-13+ |
| InChIKey | TXQSMYOXOITLJL-IQVCKYCWSA-N |
| XLogP | 4.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-phenyl-N-[(4E)-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-phenyl-N-[(4E)-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]butanamide?
The IUPAC name of 2-methyl-2-phenyl-N-[(4E)-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]butanamide (CID 167214327) is 2-methyl-2-phenyl-N-[(4E)-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]butanamide.
What is the SMILES notation for 2-methyl-2-phenyl-N-[(4E)-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]butanamide?
The canonical SMILES for 2-methyl-2-phenyl-N-[(4E)-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]butanamide is C=C/C=C(\C=C/C)C(CC)NC(=O)C(C)(CC)c1ccccc1.
What is the InChIKey of 2-methyl-2-phenyl-N-[(4E)-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]butanamide?
The InChIKey is TXQSMYOXOITLJL-IQVCKYCWSA-N. The full InChI is InChI=1S/C21H29NO/c1-6-13-17(14-7-2)19(8-3)22-20(23)21(5,9-4)18-15-11-10-12-16-18/h6-7,10-16,19H,1,8-9H2,2-5H3,(H,22,23)/b14-7-,17-13+.
What are the key properties of 2-methyl-2-phenyl-N-[(4E)-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]butanamide?
2-methyl-2-phenyl-N-[(4E)-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]butanamide has a molecular weight of 311.47 g/mol, XLogP of 4.94, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-phenyl-N-[(4E)-4-[(Z)-prop-1-enyl]hepta-4,6-dien-3-yl]butanamide is sourced from PubChem (CID 167214327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).