C22H28FN3O — CID 145487437
(3E)-N'-fluoro-2-[1-(1-phenylethenyl)piperidin-4-yl]-3-[(Z)-prop-1-enyl]hexa-3,5-dienehydrazide (PubChem CID 145487437) has the molecular formula C22H28FN3O and a molecular weight of 369.48 g/mol. Its IUPAC name is (3E)-N'-fluoro-2-[1-(1-phenylethenyl)piperidin-4-yl]-3-[(Z)-prop-1-enyl]hexa-3,5-dienehydrazide.
| Compound Name | (3E)-N'-fluoro-2-[1-(1-phenylethenyl)piperidin-4-yl]-3-[(Z)-prop-1-enyl]hexa-3,5-dienehydrazide |
|---|---|
| PubChem CID | 145487437 |
| Molecular Formula | C22H28FN3O |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | (3E)-N'-fluoro-2-[1-(1-phenylethenyl)piperidin-4-yl]-3-[(Z)-prop-1-enyl]hexa-3,5-dienehydrazide |
| SMILES | C=C/C=C(\C=C/C)C(C(=O)NNF)C1CCN(C(=C)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H28FN3O/c1-4-9-19(10-5-2)21(22(27)24-25-23)20-13-15-26(16-14-20)17(3)18-11-7-6-8-12-18/h4-12,20-21,25H,1,3,13-16H2,2H3,(H,24,27)/b10-5-,19-9+ |
| InChIKey | MOOBSEITGVEYEW-ISHQYZRCSA-N |
| XLogP | 4.18 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|