C13H14F3NO4 — CID 166390672
2-[(3,3,3-trifluoro-2-hydroxy-2-phenylpropanoyl)amino]butanoic acid (PubChem CID 166390672) has the molecular formula C13H14F3NO4 and a molecular weight of 305.25 g/mol. Its IUPAC name is 2-[(3,3,3-trifluoro-2-hydroxy-2-phenylpropanoyl)amino]butanoic acid.
| Compound Name | 2-[(3,3,3-trifluoro-2-hydroxy-2-phenylpropanoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 166390672 |
| Molecular Formula | C13H14F3NO4 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-[(3,3,3-trifluoro-2-hydroxy-2-phenylpropanoyl)amino]butanoic acid |
| SMILES | CCC(NC(=O)C(O)(c1ccccc1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C13H14F3NO4/c1-2-9(10(18)19)17-11(20)12(21,13(14,15)16)8-6-4-3-5-7-8/h3-7,9,21H,2H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | FYNAGXWDVCAFSJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |