C19H26N2O — CID 142897882
ethane;formaldehyde;N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-methylindol-3-amine (PubChem CID 142897882) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is ethane;formaldehyde;N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-methylindol-3-amine.
| Compound Name | ethane;formaldehyde;N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-methylindol-3-amine |
|---|---|
| PubChem CID | 142897882 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | ethane;formaldehyde;N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-methylindol-3-amine |
| SMILES | C=C/C=C(\C=C/C)Nc1cn(C)c2ccccc12.C=O.CC |
| InChI | InChI=1S/C16H18N2.C2H6.CH2O/c1-4-8-13(9-5-2)17-15-12-18(3)16-11-7-6-10-14(15)16;2*1-2/h4-12,17H,1H2,2-3H3;1-2H3;1H2/b9-5-,13-8+;; |
| InChIKey | LALFQHNBCFQOOR-LHQUIDTKSA-N |
| XLogP | 5.08 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|