C18H19N — CID 137398702
N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]naphthalen-1-amine (PubChem CID 137398702) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]naphthalen-1-amine.
| Compound Name | N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]naphthalen-1-amine |
|---|---|
| PubChem CID | 137398702 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]naphthalen-1-amine |
| SMILES | C/C=C\C=C(/C=C\C)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C18H19N/c1-3-5-12-16(9-4-2)19-18-14-8-11-15-10-6-7-13-17(15)18/h3-14,19H,1-2H3/b5-3-,9-4-,16-12+ |
| InChIKey | NWAAGGXVUPBAGQ-WVZINWSFSA-N |
| XLogP | 5.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|