About methane;methyl N'-ethenyl-N-naphthalen-1-ylcarbamimidate;molecular hydrogen
methane;methyl N'-ethenyl-N-naphthalen-1-ylcarbamimidate;molecular hydrogen (PubChem CID 143604612) has the molecular formula C15H20N2O
and a molecular weight of 244.34 g/mol. Its IUPAC name is methane;methyl N'-ethenyl-N-naphthalen-1-ylcarbamimidate;molecular hydrogen.
Molecular Properties
| Compound Name | methane;methyl N'-ethenyl-N-naphthalen-1-ylcarbamimidate;molecular hydrogen |
| PubChem CID | 143604612 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | methane;methyl N'-ethenyl-N-naphthalen-1-ylcarbamimidate;molecular hydrogen |
| SMILES | C.C=C/N=C(/Nc1cccc2ccccc12)OC.[H][H] |
| InChI | InChI=1S/C14H14N2O.CH4.H2/c1-3-15-14(17-2)16-13-10-6-8-11-7-4-5-9-12(11)13;;/h3-10H,1H2,2H3,(H,15,16);1H4;1H |
| InChIKey | TTZPDNBCYDLRTK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methane;methyl N'-ethenyl-N-naphthalen-1-ylcarbamimidate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;methyl N'-ethenyl-N-naphthalen-1-ylcarbamimidate;molecular hydrogen?
The IUPAC name of methane;methyl N'-ethenyl-N-naphthalen-1-ylcarbamimidate;molecular hydrogen (CID 143604612) is methane;methyl N'-ethenyl-N-naphthalen-1-ylcarbamimidate;molecular hydrogen.
What is the SMILES notation for methane;methyl N'-ethenyl-N-naphthalen-1-ylcarbamimidate;molecular hydrogen?
The canonical SMILES for methane;methyl N'-ethenyl-N-naphthalen-1-ylcarbamimidate;molecular hydrogen is C.C=C/N=C(/Nc1cccc2ccccc12)OC.[H][H].
What is the InChIKey of methane;methyl N'-ethenyl-N-naphthalen-1-ylcarbamimidate;molecular hydrogen?
The InChIKey is TTZPDNBCYDLRTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O.CH4.H2/c1-3-15-14(17-2)16-13-10-6-8-11-7-4-5-9-12(11)13;;/h3-10H,1H2,2H3,(H,15,16);1H4;1H.
What are the key properties of methane;methyl N'-ethenyl-N-naphthalen-1-ylcarbamimidate;molecular hydrogen?
methane;methyl N'-ethenyl-N-naphthalen-1-ylcarbamimidate;molecular hydrogen has a molecular weight of 244.34 g/mol, XLogP of 4.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methyl N'-ethenyl-N-naphthalen-1-ylcarbamimidate;molecular hydrogen is sourced from PubChem (CID 143604612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).