C23H21N — CID 129146030
N-[(1E,3E,5Z)-4-phenylhepta-1,3,5-trienyl]naphthalen-1-amine (PubChem CID 129146030) has the molecular formula C23H21N and a molecular weight of 311.43 g/mol. Its IUPAC name is N-[(1E,3E,5Z)-4-phenylhepta-1,3,5-trienyl]naphthalen-1-amine.
| Compound Name | N-[(1E,3E,5Z)-4-phenylhepta-1,3,5-trienyl]naphthalen-1-amine |
|---|---|
| PubChem CID | 129146030 |
| Molecular Formula | C23H21N |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | N-[(1E,3E,5Z)-4-phenylhepta-1,3,5-trienyl]naphthalen-1-amine |
| SMILES | C/C=C\C(=C/C=C/Nc1cccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C23H21N/c1-2-10-19(20-11-4-3-5-12-20)15-9-18-24-23-17-8-14-21-13-6-7-16-22(21)23/h2-18,24H,1H3/b10-2-,18-9+,19-15+ |
| InChIKey | NDTMPDHFYOONNT-HIWSQBEMSA-N |
| XLogP | 6.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|