C23H25NO — CID 143230203
4-[(1E,4E,6E,8Z)-1-amino-2-methyl-7-phenyldeca-1,4,6,8-tetraenyl]phenol (PubChem CID 143230203) has the molecular formula C23H25NO and a molecular weight of 331.46 g/mol. Its IUPAC name is 4-[(1E,4E,6E,8Z)-1-amino-2-methyl-7-phenyldeca-1,4,6,8-tetraenyl]phenol.
| Compound Name | 4-[(1E,4E,6E,8Z)-1-amino-2-methyl-7-phenyldeca-1,4,6,8-tetraenyl]phenol |
|---|---|
| PubChem CID | 143230203 |
| Molecular Formula | C23H25NO |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 4-[(1E,4E,6E,8Z)-1-amino-2-methyl-7-phenyldeca-1,4,6,8-tetraenyl]phenol |
| SMILES | C/C=C\C(=C/C=C/C/C(C)=C(/N)c1ccc(O)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H25NO/c1-3-9-19(20-11-5-4-6-12-20)13-8-7-10-18(2)23(24)21-14-16-22(25)17-15-21/h3-9,11-17,25H,10,24H2,1-2H3/b8-7+,9-3-,19-13+,23-18+ |
| InChIKey | BUMYWFPDXXLHNY-YBYONNBXSA-N |
| XLogP | 5.69 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|