C48H42N2 — CID 143848062
N-(4-ethenylphenyl)-N-[4-[(1E,3E,5Z)-1-(N-[(1E,3Z)-4-(2-methylphenyl)buta-1,3-dienyl]anilino)hepta-1,3,5-trien-4-yl]phenyl]naphthalen-1-amine (PubChem CID 143848062) has the molecular formula C48H42N2 and a molecular weight of 646.88 g/mol. Its IUPAC name is N-(4-ethenylphenyl)-N-[4-[(1E,3E,5Z)-1-(N-[(1E,3Z)-4-(2-methylphenyl)buta-1,3-dienyl]anilino)hepta-1,3,5-trien-4-yl]phenyl]naphthalen-1-amine.
| Compound Name | N-(4-ethenylphenyl)-N-[4-[(1E,3E,5Z)-1-(N-[(1E,3Z)-4-(2-methylphenyl)buta-1,3-dienyl]anilino)hepta-1,3,5-trien-4-yl]phenyl]naphthalen-1-amine |
|---|---|
| PubChem CID | 143848062 |
| Molecular Formula | C48H42N2 |
| Molecular Weight | 646.88 g/mol |
| Exact Mass | 646.33 |
| IUPAC Name | N-(4-ethenylphenyl)-N-[4-[(1E,3E,5Z)-1-(N-[(1E,3Z)-4-(2-methylphenyl)buta-1,3-dienyl]anilino)hepta-1,3,5-trien-4-yl]phenyl]naphthalen-1-amine |
| SMILES | C=Cc1ccc(N(c2ccc(C(/C=C\C)=C/C=C/N(/C=C/C=C\c3ccccc3C)c3ccccc3)cc2)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C48H42N2/c1-4-17-41(23-16-37-49(44-24-7-6-8-25-44)36-14-13-20-40-19-10-9-18-38(40)3)42-30-34-46(35-31-42)50(45-32-28-39(5-2)29-33-45)48-27-15-22-43-21-11-12-26-47(43)48/h4-37H,2H2,1,3H3/b17-4-,20-13-,36-14+,37-16+,41-23+ |
| InChIKey | AHSNPXRFNFGRFN-XWLKFRDDSA-N |
| XLogP | 13.47 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.88 |
| LogP ≤ 5 | 13.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|