C59H45N — CID 153357579
N-[(1E,3E,5Z)-6-(4-naphthalen-2-ylphenyl)-4-[4-[9-[(1Z,3Z)-penta-1,3-dienyl]phenanthren-4-yl]phenyl]hexa-1,3,5-trienyl]-4-phenylaniline (PubChem CID 153357579) has the molecular formula C59H45N and a molecular weight of 768.02 g/mol. Its IUPAC name is N-[(1E,3E,5Z)-6-(4-naphthalen-2-ylphenyl)-4-[4-[9-[(1Z,3Z)-penta-1,3-dienyl]phenanthren-4-yl]phenyl]hexa-1,3,5-trienyl]-4-phenylaniline.
| Compound Name | N-[(1E,3E,5Z)-6-(4-naphthalen-2-ylphenyl)-4-[4-[9-[(1Z,3Z)-penta-1,3-dienyl]phenanthren-4-yl]phenyl]hexa-1,3,5-trienyl]-4-phenylaniline |
|---|---|
| PubChem CID | 153357579 |
| Molecular Formula | C59H45N |
| Molecular Weight | 768.02 g/mol |
| Exact Mass | 767.36 |
| IUPAC Name | N-[(1E,3E,5Z)-6-(4-naphthalen-2-ylphenyl)-4-[4-[9-[(1Z,3Z)-penta-1,3-dienyl]phenanthren-4-yl]phenyl]hexa-1,3,5-trienyl]-4-phenylaniline |
| SMILES | C/C=C\C=C/c1cc2cccc(-c3ccc(C(/C=C\c4ccc(-c5ccc6ccccc6c5)cc4)=C/C=C/Nc4ccc(-c5ccccc5)cc4)cc3)c2c2ccccc12 |
| InChI | InChI=1S/C59H45N/c1-2-3-5-18-53-42-54-19-12-23-57(59(54)58-22-11-10-21-56(53)58)50-33-30-47(31-34-50)45(20-13-40-60-55-38-36-48(37-39-55)44-14-6-4-7-15-44)27-24-43-25-28-49(29-26-43)52-35-32-46-16-8-9-17-51(46)41-52/h2-42,60H,1H3/b3-2-,18-5-,27-24-,40-13+,45-20+ |
| InChIKey | PZNWDBFAHRAXMQ-HHJCXRQDSA-N |
| XLogP | 16.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.02 |
| LogP ≤ 5 | 16.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|